PPIRE17567
Target Protein Information
| Protein_Name | High affinity immunoglobulin epsilon receptor subunit alpha |
|---|---|
| Protein_Sequence | MAPAMESPTLLCVALLFFAPDGVLAVPQKPKVSLNPPWNRIFKGENVTLTCNGNNFFEVSSTKWFHNGSLSEETNSSLNIVNAKFEDSGEYKCQHQQVNESEPVYLEVFSDWLLLQASAEVVMEGQPLFLRCHGWRNWDVYKVIYYKDGEALKYWYENHNISITNATVEDSGTYYCTGKVWQLDYESEPLNITVIKAPREKYWLQFFIPLLVVILFAVDTGLFISTQQQVTFLLKIKRTRKGFRLLNPHPKPNPKNN |
| Organism_Source | Homo sapiens |
| Functional_Classification | Fc receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | FCER1A |
| UniProt_ID | P12319 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MCD |
|---|---|
| Peptide_Sequence | IKCNCKRHVIKPHICRKICGKN |
| Peptide_Length | 22 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)CC)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | Multi-point cyclization; C3<-->C15; disulfide bond; C5<-->C19; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2592.24 |
|---|---|
| Aliphatic_Index | 84.09091 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.13636 |
| Charge_at_pH_7 | 6.93042 |
| Isoelectric_Point | 10.62841 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 38 |
| Number_of_Hydrogen_Bond_Donors | 41 |
| Topological_Polar_Surface_Area | 1063.07000 |
| X_logP_energy | -9.86976 |
Interaction Information
| Affinity | IC50=132 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Partial Alanine Scan of Mast Cell Degranulating Peptide (MCD): Importance of the Histidine- and Arginine Residues |
| Release_Year | 2004 |
| PMID | 15214434 |
| DOI | 10.1002/psc.532 |