PPIRE17750
Target Protein Information
| Protein_Name | CD2 antigen cytoplasmic tail-binding protein 2 |
|---|---|
| Protein_Sequence | MPKRKVTFQGVGDEEDEDEIIVPKKKLVDPVAGSGGPGSRFKGKHSLDSDEEEDDDDGGSSKYDILASEDVEGQEAATLPSEGGVRITPFNLQEEMEEGHFDADGNYFLNRDAQIRDSWLDNIDWVKIRERPPGQRQASDSEEEDSLGQTSMSAQALLEGLLELLLPRETVAGALRRLGARGGGKGRKGPGQPSSPQRLDRLSGLADQMVARGNLGVYQETRERLAMRLKGLGCQTLGPHNPTPPPSLDMFAEELAEEELETPTPTQRGEAESRGDGLVDVMWEYKWENTGDAELYGPFTSAQMQTWVSEGYFPDGVYCRKLDPPGGQFYNSKRIDFDLYT |
| Organism_Source | Homo sapiens |
| Functional_Classification | GYF domains |
| Cellular_Localization | Nucleus |
| Gene_Names | CD2BP2 |
| UniProt_ID | O95400 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | 19b |
|---|---|
| Peptide_Sequence | EFGPPPGWKG |
| Peptide_Length | 10 |
| Peptide_SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCC(=O)O)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | fluorescein |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1071.20 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 2.70000 |
| Charge_at_pH_7 | -0.00054 |
| Isoelectric_Point | 6.40880 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 11 |
| Topological_Polar_Surface_Area | 377.96000 |
| X_logP_energy | -1.86520 |
Interaction Information
| Affinity | KD=49 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | 1GYF |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Resin-Bound Aminofluorescein for C-Terminal Labeling of Peptides: High-Affinity Polarization Probes Binding to Polyproline-Specific GYF Domains |
| Release_Year | 2008 |
| PMID | 18803191 |
| DOI | 10.1002/cbic.200800329 |