PPIRE17795
Target Protein Information
| Protein_Name | Troponin C skeletal muscle |
|---|---|
| Protein_Sequence | MASMTDQQAEARAFLSEEMIAEFKAAFDMFDADGGGDISTKELGTVMRMLGQNPTKEELDAIIEEVDEDGSGTIDFEEFLVMMVRQMKEDAKGKSEEELANCFRIFDKNADGFIDIEELGEILRATGEHVTEEDIEDLMKDSDKNNDGRIDFDEFLKMMEGVQ |
| Organism_Source | Gallus gallus |
| Functional_Classification | EF hand calcium binding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TNNC2 |
| UniProt_ID | P02588 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Rp40 |
|---|---|
| Peptide_Sequence | GDEEKRNRAITARRQHLKSVMLQIAATELEKEEGRREAEK |
| Peptide_Length | 40 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)CN)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O)[C@@H](C)O)[C@@H](C)CC)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 4678.26 |
|---|---|
| Aliphatic_Index | 68.50000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.30000 |
| Charge_at_pH_7 | 1.10234 |
| Isoelectric_Point | 9.36811 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 68 |
| Number_of_Hydrogen_Bond_Donors | 79 |
| Topological_Polar_Surface_Area | 2228.04000 |
| X_logP_energy | -25.07778 |
Interaction Information
| Affinity | KD=2 uM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | 1JC2 |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure Dynamics and Thermodynamics of the Structural Domain of Troponin C in Complex with the Regulatory Peptide 1-40 of Troponin I |
| Release_Year | 2001 |
| PMID | 11513585 |
| DOI | 10.1021/bi010748+ |