PPIRE17945
Target Protein Information
| Protein_Name | NKG2-A/NKG2-B type II integral membrane protein |
|---|---|
| Protein_Sequence | MDNQGVIYSDLNLPPNPKRQQRKPKGNKNSILATEQEITYAELNLQKASQDFQGNDKTYHCKDLPSAPEKLIVGILGIICLILMASVVTIVVIPSTLIQRHNNSSLNTRTQKARHCGHCPEEWITYSNSCYYIGKERRTWEESLLACTSKNSSLLSIDNEEEMKFLSIISPSSWIGVFRNSSHHPWVTMNGLAFKHEIKDSDNAELNCAVLQVNRLKSAQCGSSIIYHCKHKL |
| Organism_Source | Homo sapiens |
| Functional_Classification | C type lectin like receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | KLRC1 |
| UniProt_ID | P26715 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | HLA-Cw3 leader sequence-derived peptide |
|---|---|
| Peptide_Sequence | VMAPRTLIL |
| Peptide_Length | 9 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@@H](N)C(C)C)[C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1013.31 |
|---|---|
| Aliphatic_Index | 173.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.44444 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_Point | 10.55000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 369.46000 |
| X_logP_energy | -1.00573 |
Interaction Information
| Affinity | KD=7.35 mM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Kinetics and peptide dependency of the binding of the inhibitory NK receptor CD94/NKG2-A and the activating receptor CD94/NKG2-C to HLA-E |
| Release_Year | 1999 |
| PMID | 10428963 |
| DOI | 10.1093/emboj/18.15.4250 |