PPIRE18294
Target Protein Information
| Protein_Name | Apical membrane antigen 1 |
|---|---|
| Protein_Sequence | CPVFGKGIIIENSKTTFLTPVATENQDLKDGGFAFPPTKPLMSPMTLDHMRDFYKDNEYVKNLDELTLCSRHAGNMNPDNDKNSNYKYPAVYDYNDKKCHILYIAAQENNGPRYCNKDESKRNSMFCFRPAKDISFQNYTYLSKNVVDNWEKVCPRKNLQNAKFGLWVDGNCEDIPHVNEFSANDLFECNKLVFELSASDQPKQYEQHLTDYEKIKEGFKNKNASMIKSAFLPTGAFKADRYKSHGKGYNWGNYNTETHKCEIFNVKPTCLINNSSYIATTALSHPIEVENNFPCSLYKDEIMKEIERESKRIKLNDNDDEGNKKIIAPRIFISDDKDSLKCPCDPEMVSNSTCRFFVCKCVERRAEVTSNNEVVVKEEYKDEYADIPEHKPTYDNMKIIIASSAAVAVLATILMVYLYKRKGNAEKYDKMDEPQHYGKSNSRNDEMLD |
| Organism_Source | Plasmodium falciparum |
| Functional_Classification | adhesion proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | AMA1 |
| UniProt_ID | A0A0X8IHV3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | peptide 4313 |
|---|---|
| Peptide_Sequence | DAEVAGTQYRLPSGKCPVFG |
| Peptide_Length | 20 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(=O)O)C(C)C)[C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2095.36 |
|---|---|
| Aliphatic_Index | 58.50000 |
| Aromaticity | 0.10000 |
| Average_Rotatable_Bonds | 3.20000 |
| Charge_at_pH_7 | -0.06292 |
| Isoelectric_Point | 6.31437 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 30 |
| Number_of_Hydrogen_Bond_Donors | 30 |
| Topological_Polar_Surface_Area | 864.94000 |
| X_logP_energy | -9.59483 |
Interaction Information
| Affinity | KD=120 nM |
|---|---|
| Affinity_Assay | erythrocyte binding assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | NMR structure of Plasmodium falciparum malaria peptide correlates with protective immunity |
| Release_Year | 2002 |
| PMID | 12031287 |
| DOI | 10.1016/S0304-4165(02)00203-9 |