PPIRE18382
Target Protein Information
| Protein_Name | B-cell lymphoma/leukemia 10 |
|---|---|
| Protein_Sequence | MEPTAPSLTEEDLTEVKKDALENLRVYLCEKIIAERHFDHLRAKKILSREDTEEISCRTSSRKRAGKLLDYLQENPKGLDTLVESIRREKTQNFLIQKITDEVLKLRNIKLEHLKGLKCSSCEPFPDGATNNLSRSNSDESNFSEKLRASTVMYHPEGESSTTPFFSTNSSLNLPVLEVGRTENTIFSSTTLPRPGDPGAPPLPPDLQLEEEGTCANSSEMFLPLRSRTVSRQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | CARD containing adaptors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | BCL10 |
| UniProt_ID | O95999 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | BCL10-(91-98) |
|---|---|
| Peptide_Sequence | TQNFLIQK |
| Peptide_Length | 8 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 991.16 |
|---|---|
| Aliphatic_Index | 97.50000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 4.25000 |
| Charge_at_pH_7 | 0.99769 |
| Isoelectric_Point | 9.70000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 442.54000 |
| X_logP_energy | -3.95700 |
Interaction Information
| Affinity | IC50=70 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Generation and functional characterization of a BCL10-inhibitory peptide that represses NF-KappaB activation |
| Release_Year | 2009 |
| PMID | 19538180 |
| DOI | 10.1042/BJ20090055 |