PPIRE18383
Target Protein Information
| Protein_Name | B-cell lymphoma/leukemia 10 |
|---|---|
| Protein_Sequence | MEPTAPSLTEEDLTEVKKDALENLRVYLCEKIIAERHFDHLRAKKILSREDTEEISCRTSSRKRAGKLLDYLQENPKGLDTLVESIRREKTQNFLIQKITDEVLKLRNIKLEHLKGLKCSSCEPFPDGATNNLSRSNSDESNFSEKLRASTVMYHPEGESSTTPFFSTNSSLNLPVLEVGRTENTIFSSTTLPRPGDPGAPPLPPDLQLEEEGTCANSSEMFLPLRSRTVSRQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | CARD containing adaptors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | BCL10 |
| UniProt_ID | O95999 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Tat 10-(91-98) |
|---|---|
| Peptide_Sequence | GRKKRRQRRRPPQXXTQNFLIQK |
| Peptide_Length | 23 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)CN)[C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | X14=Beta-alanine; X15=Beta-alanine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2806.28 |
|---|---|
| Aliphatic_Index | 33.91304 |
| Aromaticity | 0.04348 |
| Average_Rotatable_Bonds | 4.34783 |
| Charge_at_pH_7 | 8.99708 |
| Isoelectric_Point | 13.20514 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 39 |
| Number_of_Hydrogen_Bond_Donors | 49 |
| Topological_Polar_Surface_Area | 1371.08000 |
| X_logP_energy | -17.40978 |
Interaction Information
| Affinity | IC50=5 uM |
|---|---|
| Affinity_Assay | co-immunoprecipitation |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Generation and functional characterization of a BCL10-inhibitory peptide that represses NF-KappaB activation |
| Release_Year | 2009 |
| PMID | 19538180 |
| DOI | 10.1042/BJ20090055 |