PPIRE18481
Target Protein Information
| Protein_Name | Troponin I cardiac muscle |
|---|---|
| Protein_Sequence | MADESSDAAGEPQPAPAPVRRRSSANYRAYATEPHAKKKSKISASRKLQLKTLMLQIAKQEMEREAEERRGEKGRVLSTRCQPLVLDGLGFEELQDLCRQLHARVDKVDEERYDVEAKVTKNITEIADLTQKIYDLRGKFKRPTLRRVRISADAMMQALLGTRAKESLDLRAHLKQVKKEDIEKENREVGDWRKNIDALSGMEGRKKKFEG |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | muscle regulatory proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Tnni3 |
| UniProt_ID | P23693 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | JP5-19H |
|---|---|
| Peptide_Sequence | FYSHSFHENWPS |
| Peptide_Length | 12 |
| Peptide_SMILES | NC(=O)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1537.61 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | -0.81927 |
| Isoelectric_Point | 6.49754 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 21 |
| Topological_Polar_Surface_Area | 609.09000 |
| X_logP_energy | -4.95630 |
Interaction Information
| Affinity | KD=6.3 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | High Affinity Peptides for the Recognition of the Heart Disease Biomarker Troponin I Identified Using Phage Display |
| Release_Year | 2010 |
| PMID | 19891006 |
| DOI | 10.1002/bit.22597 |