PPIRE18482
Target Protein Information
| Protein_Name | Troponin I cardiac muscle |
|---|---|
| Protein_Sequence | MADGSSDAAREPRPAPAPIRRRSSNYRAYATEPHAKKKSKISASRKLQLKTLLLQIAKQELEREAEERRGEKGRALSTRCQPLELAGLGFAELQDLCRQLHARVDKVDEERYDIEAKVTKNITEIADLTQKIFDLRGKFKRPTLRRVRISADAMMQALLGARAKESLDLRAHLKQVKKEDTEKENREVGDWRKNIDALSGMEGRKKKFES |
| Organism_Source | Homo sapiens |
| Functional_Classification | muscle regulatory proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TNNI3 |
| UniProt_ID | P19429 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | JP5-20R |
|---|---|
| Peptide_Sequence | FHSSWPVNGSTI |
| Peptide_Length | 12 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)[C@@H](C)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1331.45 |
|---|---|
| Aliphatic_Index | 56.66667 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.08333 |
| Charge_at_pH_7 | 0.08889 |
| Isoelectric_Point | 7.55032 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 19 |
| Number_of_Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 543.11000 |
| X_logP_energy | -6.26360 |
Interaction Information
| Affinity | KD=3.1 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | High Affinity Peptides for the Recognition of the Heart Disease Biomarker Troponin I Identified Using Phage Display |
| Release_Year | 2010 |
| PMID | 19891006 |
| DOI | 10.1002/bit.22597 |