PPIRE18536
Target Protein Information
| Protein_Name | Alpha-1-syntrophin |
|---|---|
| Protein_Sequence | MASGRRAPRTGLLELRAGAGSGAGGERWQRVLLSLAEDVLTVSPADGDPGPEPGAPREQEPAQLNGAAEPGAGPPQLPEALLLQRRRVTVRKADAGGLGISIKGGRENKMPILISKIFKGLAADQTEALFVGDAILSVNGEDLSSATHDEAVQVLKKTGKEVVLEVKYMKDVSPYFKNSTGGTSVGWDSPPASPLQRQPSSPGPTPRNFSEAKHMSLKMAYVSKRCTPNDPEPRYLEICSADGQDTLFLRAKDEASARSWATAIQAQVNTLTPRVKDELQALLAATSTAGSQDIKQIGWLTEQLPSGGTAPTLALLTEKELLLYLSLPETREALSRPARTAPLIATRLVHSGPSKGSVPYDAELSFALRTGTRHGVDTHLFSVESPQELAAWTRQLVDGCHRAAEGVQEVSTACTWNGRPCSLSVHIDKGFTLWAAEPGAARAVLLRQPFEKLQMSSDDGASLLFLDFGGAEGEIQLDLHSCPKTIVFIIHSFLSAKVTRLGLLA |
| Organism_Source | Homo sapiens |
| Functional_Classification | PDZ domain containing scaffold proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | SNTA1 |
| UniProt_ID | Q13424 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | VKESLV |
|---|---|
| Peptide_Sequence | VKESLV |
| Peptide_Length | 6 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 673.81 |
|---|---|
| Aliphatic_Index | 161.66667 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.83333 |
| Charge_at_pH_7 | -0.00054 |
| Isoelectric_Point | 6.40880 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 292.37000 |
| X_logP_energy | -1.83350 |
Interaction Information
| Affinity | KD=7.6 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Design synthesis structure and binding properties of PDZ binding cyclic b-finger peptides |
| Release_Year | 2010 |
| PMID | 20394733 |
| DOI | 10.1016/j.bbrc.2010.04.060 |