PPIRE18586
Target Protein Information
| Protein_Name | Proto-oncogene Mas |
|---|---|
| Protein_Sequence | MDQSNMTSFAEEKAMNTSSRNASLGTSHPPIPIVHWVIMSISPLGFVENGILLWFLCFRMRRNPFTVYITHLSIADISLLFCIFILSIDYALDYELSSGHYYTIVTLSVTFLFGYNTGLYLLTAISVERCLSVLYPIWYRCHRPKHQSAFVCALLWALSCLVTTMEYVMCIDSGEESHSQSDCRAVIIFIAILSFLVFTPLMLVSSTILVVKIRKNTWASHSSKLYIVIMVTIIIFLIFAMPMRVLYLLYYEYWSTFGNLHNISLLFSTINSSANPFIYFFVGSSKKKRFRESLKVVLTRAFKDEMQPRRQEGNGNTVSIETVV |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Mas1 |
| UniProt_ID | P12526 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MBP7 |
|---|---|
| Peptide_Sequence | KAQLRRLS |
| Peptide_Length | 8 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 971.17 |
|---|---|
| Aliphatic_Index | 110.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.37500 |
| Charge_at_pH_7 | 2.99768 |
| Isoelectric_Point | 12.51648 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 480.16000 |
| X_logP_energy | -5.18266 |
Interaction Information
| Affinity | EC50=36.41 mM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification and characterization of surrogate peptide ligand for orphan G protein-coupled receptor mas using phage-displayed peptide library |
| Release_Year | 2006 |
| PMID | 16336942 |
| DOI | 10.1016/j.bcp.2005.10.050 |