PPIRE18665
Target Protein Information
| Protein_Name | HLA class II histocompatibility antigen DM alpha chain |
|---|---|
| Protein_Sequence | MGHEQNQGAALLQMLPLLWLLPHSWAVPEAPTPMWPDDLQNHTFLHTVYCQDGSPSVGLSEAYDEDQLFFFDFSQNTRVPRLPEFADWAQEQGDAPAILFDKEFCEWMIQQIGPKLDGKIPVSRGFPIAEVFTLKPLEFGKPNTLVCFVSNLFPPMLTVNWQHHSVPVEGFGPTFVSAVDGLSFQAFSYLNFTPEPSDIFSCIVTHEIDRYTAIAYWVPRNALPSDLLENVLCGVAFGLGVLGIIVGIVLIIYFRKPCSGD |
| Organism_Source | Homo sapiens |
| Functional_Classification | MHC class 2 molecules |
| Cellular_Localization | Plasma membrane |
| Gene_Names | HLA-DMA |
| UniProt_ID | P28067 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CLIP |
|---|---|
| Peptide_Sequence | VSKMRMATPLLMQ |
| Peptide_Length | 13 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1505.92 |
|---|---|
| Aliphatic_Index | 90.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.92308 |
| Charge_at_pH_7 | 1.99769 |
| Isoelectric_Point | 11.65178 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 22 |
| Number_of_Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 575.20000 |
| X_logP_energy | -4.21963 |
Interaction Information
| Affinity | KD=0.7 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Conformational lability in the class II MHC 310 helix and adjacent extended strand dictate HLA-DM susceptibility and peptide exchange |
| Release_Year | 2011 |
| PMID | 22084083 |
| DOI | 10.1073/pnas.1108074108 |