PPIRE18679
Target Protein Information
| Protein_Name | Glyceraldehyde-3-phosphate dehydrogenase |
|---|---|
| Protein_Sequence | MVKVGVNGFGRIGRLVTRAAFNSGKVDVVAINDPFIDLHYMVYMFQYDSTHGKFHGTVKAENGKLVINGKAITIFQERDPANIKWGDAGAEYVVESTGVFTTMEKAGAHLKGGAKRVIISAPSADAPMFVMGVNHEKYDNSLKIVSNASCTTNCLAPLAKVIHDHFGIVEGLMTTVHAITATQKTVDGPSGKLWRDGRGAAQNIIPASTGAAKAVGKVIPELNGKLTGMAFRVPTPNVSVVDLTCRLEKAAKYDDIKKVVKQASEGPLKGILGYTEDQVVSCDFNSATHSSTFDAGAGIALNDHFVKLISWYDNEFGYSNRVVDLMVHMASKE |
| Organism_Source | Oryctolagus cuniculus |
| Functional_Classification | dehydrogenases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | GAPDH |
| UniProt_ID | P46406 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | B3P |
|---|---|
| Peptide_Sequence | MEELQDDYEDMMEEN |
| Peptide_Length | 15 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCSC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1921.01 |
|---|---|
| Aliphatic_Index | 26.00000 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 4.53333 |
| Charge_at_pH_7 | -7.99265 |
| Isoelectric_Point | 3.04983 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 30 |
| Number_of_Hydrogen_Bond_Donors | 27 |
| Topological_Polar_Surface_Area | 875.53000 |
| X_logP_energy | -7.67180 |
Interaction Information
| Affinity | Ki=140 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | 3BTB |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Insights into Tyrosine Phosphorylation Control of Protein-Protein Association from the NMR Structure of a Band 3 Peptide Inhibitor Bound to Glyceraldehyde-3-phosphate Dehydrogenase |
| Release_Year | 1998 |
| PMID | 9454576 |
| DOI | 10.1021/bi971445b |