PPIRE18982
Target Protein Information
| Protein_Name | Peroxide operon regulator |
|---|---|
| Protein_Sequence | MAAHELKEALETLKETGVRITPQRHAILEYLVNSMAHPTADDIYKALEGKFPNMSVATVYNNLRVFRESGLVKELTYGDASSRFDFVTSDHYHAICENCGKIVDFHYPGLDEVEQLAAHVTGFKVSHHRLEIYGVCQECSKKENH |
| Organism_Source | Bacillus subtilis (strain 168) |
| Functional_Classification | Metal dependent transcriptional repressors Fur family |
| Cellular_Localization | Cytoplasm |
| Gene_Names | perR |
| UniProt_ID | P71086 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | LTTC |
|---|---|
| Peptide_Sequence | PCENCGKpPGRVCQECS |
| Peptide_Length | 17 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CS)NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-main chain cyclization; E3<-->P1; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1807.06 |
|---|---|
| Aliphatic_Index | 17.05882 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.29412 |
| Charge_at_pH_7 | -0.24666 |
| Isoelectric_Point | 6.14093 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 29 |
| Number_of_Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 766.28000 |
| X_logP_energy | -11.51473 |
Interaction Information
| Affinity | KD=12.59 fM |
|---|---|
| Affinity_Assay | circular dichroism titration |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Cooperative Metal Binding and Helical Folding in Model Peptides of Treble-Clef Zinc Fingers |
| Release_Year | 2009 |
| PMID | 19388025 |
| DOI | 10.1002/chem.200900147 |