PPIRE19016
Target Protein Information
| Protein_Name | Proteasome subunit beta type-5 |
|---|---|
| Protein_Sequence | MALASVLERPLPVNQRGFFGLGGRADLLDLGPGSLSDGLSLAAPGWGVPEEPGIEMLHGTTTLAFKFRHGVIVAADSRATAGAYIASQTVKKVIEINPYLLGTMAGGAADCSFWERLLARQCRIYELRNKERISVAAASKLLANMVYQYKGMGLSMGTMICGWDKRGPGLYYVDSEGNRISGATFSVGSGSVYAYGVMDRGYSYDLEVEQAYDLARRAIYQATYRDAYSGGAVNLYHVREDGWIRVSSDNVADLHEKYSGSTP |
| Organism_Source | Homo sapiens |
| Functional_Classification | proteasome |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PSMB5 |
| UniProt_ID | P28074 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | IIMLK |
|---|---|
| Peptide_Sequence | IIMLK |
| Peptide_Length | 5 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O)[C@@H](C)CC |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 616.86 |
|---|---|
| Aliphatic_Index | 234.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.40000 |
| Charge_at_pH_7 | 0.99769 |
| Isoelectric_Point | 9.70000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 8 |
| Number_of_Hydrogen_Bond_Donors | 7 |
| Topological_Polar_Surface_Area | 205.74000 |
| X_logP_energy | 1.35790 |
Interaction Information
| Affinity | IC50=129 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Disulfide-rich proteasome inhibitor Roseltide rT7 is a disulfide-rich anionic and cell-penetrating peptide that inhibits proteasomal degradation |
| Release_Year | 2019 |
| PMID | 31727740 |
| DOI | 10.1074/jbc.RA119.010796 |