PPIRE19028
Target Protein Information
| Protein_Name | High affinity copper uptake protein 1 |
|---|---|
| Protein_Sequence | MDHSHHMGMSYMDSNSTMQPSHHHPTTSASHSHGGGDSSMMMMPMTFYFGFKNVELLFSGLVINTAGEMAGAFVAVFLLAMFYEGLKIARESLLRKSQVSIRYNSMPVPGPNGTILMETHKTVGQQMLSFPHLLQTVLHIIQVVISYFLMLIFMTYNGYLCIAVAAGAGTGYFLFSWKKAVVVDITEHCH |
| Organism_Source | Homo sapiens |
| Functional_Classification | SLC family copper transporters |
| Cellular_Localization | Plasma membrane |
| Gene_Names | SLC31A1 |
| UniProt_ID | O15431 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ctr1-14 |
|---|---|
| Peptide_Sequence | MDHSHHMGMSYMDS |
| Peptide_Length | 14 |
| Peptide_SMILES | CSCC[C@H](NC(=O)CNC(=O)[C@H](CCSC)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1665.85 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.07143 |
| Average_Rotatable_Bonds | 3.85714 |
| Charge_at_pH_7 | -1.72925 |
| Isoelectric_Point | 6.20432 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 28 |
| Number_of_Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 683.18000 |
| X_logP_energy | -7.88350 |
Interaction Information
| Affinity | KD=0.2 pM |
|---|---|
| Affinity_Assay | Competition binding assay |
| PDB_ID | None |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Model Peptide Studies Reveal a Mixed Histidine-Methionine Cu(I) Binding Site at the N-Terminus of Human Copper Transporter 1 |
| Release_Year | 2015 |
| PMID | 26258435 |
| DOI | 10.1021/acs.inorgchem.5b01162 |