PPIRE19255
Target Protein Information
| Protein_Name | Urotensin-2 receptor |
|---|---|
| Protein_Sequence | MALTPESPSSFPGLAATGSSVPEPPGGPNATLNSSWASPTEPSSLEDLVATGTIGTLLSAMGVVGVVGNAYTLVVTCRSLRAVASMYVYVVNLALADLLYLLSIPFIVATYVTKEWHFGDVGCRVLFGLDFLTMHASIFTLTVMSSERYAAVLRPLDTVQRPKGYRKLLALGTWLLALLLTLPVMLAMRLVRRGPKSLCLPAWGPRAHRAYLTLLFATSIAGPGLLIGLLYARLARAYRRSQRASFKRARRPGARALRLVLGIVLLFWACFLPFWLWQLLAQYHQAPLAPRTARIVNYLTTCLTYGNSCANPFLYTLLTRNYRDHLRGRVRGPGSGGGRGPVPSLQPRARFQRCSGRSLSSCSPQPTDSLVLAPAAPARPAPEGPRAPA |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | UTS2R |
| UniProt_ID | Q9UKP6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | compound 6 |
|---|---|
| Peptide_Sequence | XcXFwXYCV |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CS)NC(=O)CN)C(=O)O |
| Chemical_Modification | X1=p-chlorophenylalanine; X2=penicillamine; w4=D-tryptophan; X5=ornithine |
| Cyclization_Method | Side chain-side chain cyclization; X2<-->C7; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 991.15 |
|---|---|
| Aliphatic_Index | 32.22222 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 2.88889 |
| Charge_at_pH_7 | -0.12682 |
| Isoelectric_Point | 5.82405 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 332.14000 |
| X_logP_energy | -1.39850 |
Interaction Information
| Affinity | Ki=9.55 nM |
|---|---|
| Affinity_Assay | Radioligand binding assay |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | New Insight into the Binding Mode of Peptide Ligands at Urotensin-II Receptor: Structure-Activity Relationships Study on P5U and Urantide |
| Release_Year | 2009 |
| PMID | 19432421 |
| DOI | 10.1021/jm900148c |