PPIRE19440
Target Protein Information
| Protein_Name | Urotensin-2 receptor |
|---|---|
| Protein_Sequence | MALTPESPSSFPGLAATGSSVPEPPGGPNATLNSSWASPTEPSSLEDLVATGTIGTLLSAMGVVGVVGNAYTLVVTCRSLRAVASMYVYVVNLALADLLYLLSIPFIVATYVTKEWHFGDVGCRVLFGLDFLTMHASIFTLTVMSSERYAAVLRPLDTVQRPKGYRKLLALGTWLLALLLTLPVMLAMRLVRRGPKSLCLPAWGPRAHRAYLTLLFATSIAGPGLLIGLLYARLARAYRRSQRASFKRARRPGARALRLVLGIVLLFWACFLPFWLWQLLAQYHQAPLAPRTARIVNYLTTCLTYGNSCANPFLYTLLTRNYRDHLRGRVRGPGSGGGRGPVPSLQPRARFQRCSGRSLSSCSPQPTDSLVLAPAAPARPAPEGPRAPA |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | UTS2R |
| UniProt_ID | Q9UKP6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Compound 2 |
|---|---|
| Peptide_Sequence | DXFXKYCV |
| Peptide_Length | 8 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| Chemical_Modification | X2=2-2-dimethylcysteine; X4=D-Tpi |
| Cyclization_Method | Side chain-side chain cyclization; X2<-->C7; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 888.01 |
|---|---|
| Aliphatic_Index | 36.25000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.37500 |
| Charge_at_pH_7 | -0.06469 |
| Isoelectric_Point | 6.15753 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 350.57000 |
| X_logP_energy | -2.56480 |
Interaction Information
| Affinity | Ki=6.92 nM |
|---|---|
| Affinity_Assay | Radioligand binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | New insight into the binding mode of peptides at urotensin-II receptor by Trp-constrained analogues of P5U and urantide |
| Release_Year | 2013 |
| PMID | 23526702 |
| DOI | 10.1002/psc.2498 |