PPIPT00800
Target Protein Information
| Protein_Name | Neutrophil cytosol factor 1 |
|---|---|
| Protein_Sequence | MGDTFIRHIALLGFEKRFVPSQHYVYMFLVKWQDLSEKVVYRRFTEIYEFHKTLKEMFPIEAGAINPENRIIPHLPAPKWFDGQRAAENRQGTLTEYCSTLMSLPTKISRCPHLLDFFKVRPDDLKLPTDNQTKKPETYLMPKDGKSTATDITGPIILQTYRAIANYEKTSGSEMALSTGDVVEVVEKSESGWWFCQMKAKRGWIPASFLEPLDSPDETEDPEPNYAGEPYVAIKAYTAVEGDEVSLLEGEAVEVIHKLLDGWWVIRKDDVTGYFPSMYLQKSGQDVSQAQRQIKRGAPPRRSSIRNAHSIHQRSRKRLSQDAYRRNSVRFLQQRRRQARPGPQSPGSPLEEERQTQRSKPQPAVPPRPSADLILNRCSESTKRKLASAV |
| Organism_Source | Homo sapiens |
| Functional_Classification | NADPH oxidase cytosolic subunit |
| Cellular_Localization | Cytoplasm |
| Gene_Names | NCF1 |
| UniProt_ID | P14598 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | p22-phox proline-rich peptide |
|---|---|
| Peptide_Sequence | PPSNPPPRPP |
| Peptide_Length | 10 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1055.20 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.00000 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_point | 10.55000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 383.71000 |
| X_logP_energy | -4.64563 |
Interaction Information
| Affinity | IC50=5.8 nM |
|---|---|
| Affinity_Assay | HTRF |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Method for the screening of compounds that inhibit the interaction between a proline-rich peptide and a SH3 domain-comprising peptide |
| Release_Year | 2003 |
| Patent_ID | EP001281963A2 |