PPIPT02610
Target Protein Information
| Protein_Name | Cytokine receptor-like factor 2 |
|---|---|
| Protein_Sequence | MGRLVLLWGAAVFLLGGWMALGQGGAAEGVQIQIIYFNLETVQVTWNASKYSRTNLTFHYRFNGDEAYDQCTNYLLQEGHTSGCLLDAEQRDDILYFSIRNGTHPVFTASRWMVYYLKPSSPKHVRFSWHQDAVTVTCSDLSYGDLLYEVQYRSPFDTEWQSKQENTCNVTIEGLDAEKCYSFWVRVKAMEDVYGPDTYPSDWSEVTCWQRGEIRDACAETPTPPKPKLSKFILISSLAILLMVSLLLLSLWKLWRVKKFLIPSVPDPKSIFPGLFEIHQGNFQEWITDTQNVAHLHKMAGAEQESGPEEPLVVQLAKTEAESPRMLDPQTEEKEASGGSLQLPHQPLQGGDVVTIGGFTFVMNDRSYVAL |
| Organism_Source | Homo sapiens |
| Functional_Classification | Class I cytokine receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CRLF2 |
| UniProt_ID | Q9HC73 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | TDAHASV |
|---|---|
| Peptide_Sequence | TDAHASV |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | none |
| Linear/Cyclic | Linear |
| N-terminal_Modification | free |
| C-terminal_Modification | free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 699.72 |
|---|---|
| Aliphatic_Index | 70.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.85714 |
| Charge_at_pH_7 | -0.91066 |
| Isoelectric_point | 5.29226 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 12 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 344.36000 |
| X_logP_energy | -5.18350 |
Interaction Information
| Affinity | KD=27.9 nM |
|---|---|
| Affinity_Assay | flow cytometry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Crlf-2 binding peptides, protocells and viral-like particles useful in the treatment of cancer, including acute lymphoblastic leukemia (all) |
| Release_Year | 2013 |
| Patent_ID | WO2013103614A1 |